Drugs Information: Picosulfuric acid
Basic Information
|
|
||
| ID | DDInter1464 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H15No8S2 | |
| Molecular Weight | 437.449 | |
| Description | Picosulfuric acid is a stimulant laxative used for cleansing of the colon as a preparation for colonoscopy in adults. | |
| ATC Classification | A06AB08 A06AB58 | |
| IUPAC Name | {4-[(Pyridin-2-Yl)[4-(Sulfooxy)Phenyl]Methyl]Phenyl}Oxidanesulfonic Acid | |
| InChI | Inchi=1S/C18H15No8S2/C20-28(21,22)26-15-8-4-13(5-9-15)18(17-3-1-2-12-19-17)14-6-10-16(11-7-14)27-29(23,24)25/H1-12,18H,(H,20,21,22)(H,23,24,25) | |
| InChI Key | UJIDKYTZIQTXPM-UHFFFAOYSA-N | |
| Canonical SMILES | OS(=O)(=O)OC1=CC=C(C=C1)C(C1=CC=C(OS(O)(=O)=O)C=C1)C1=CC=CC=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Picosulfuric acid
| Severity level | ID | Name | Mechanism | Detail |
|---|