Drugs Information: Pimecrolimus
Basic Information
|
|
||
| ID | DDInter1468 | |
| Drug Type | small molecule | |
| Molecular Formula | C43H68Clno11 | |
| Molecular Weight | 810.466 | |
| Description | Pimecrolimus is a topical calcineurin inhibitor used in the treatment of mild-moderate atopic dermatitis who are not candidates for other types of therapy due to previous lack of response or other reasons. | |
| ATC Classification | D11AH02 | |
| IUPAC Name | (1R,9S,12S,13R,14S,17R,18E,21S,23S,24R,25S,27R)-12-[(1E)-1-[(1R,3R,4S)-4-Chloro-3-Methoxycyclohexyl]Prop-1-En-2-Yl]-17-Ethyl-1,1 | |
| InChI | Inchi=1S/C43H68Clno11/C1-10-30-18-24(2)17-25(3)19-36(53-8)39-37(54-9)21-27(5)43(51,56-39)40(48)41(49)45-16-12-11-13-32(45)42(50)55-38(28(6)33(46)23-34(30)47)26(4)20-29-14-15-31(44)35(22-29)52-7/H18,20,25,27-33,35-39,46,51H,10-17,19,21-23H2,1-9H3/B24-18+,26-20+/T25-,27+,28+,29-,30+,31-,32-,33-,35+,36-,37-,38+,39+,43+/M0/S1 | |
| InChI Key | KASDHRXLYQOAKZ-XDSKOBMDSA-N | |
| Canonical SMILES | [H][C@]1(CC[C@H](Cl)[C@@H](C1)OC)\C=C(/C)[C@@]1([H])OC(=O)[C@]2([H])CCCCN2C(=O)C(=O)[C@]2(O)O[C@@]([H])([C@H](C[C@H]2C)OC)[C@H](C[C@@H](C)C\C(C)=C\[C@@H](CC)C(=O)C[C@H](O)[C@H]1C)OC | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Pimecrolimus
| Severity level | ID | Name | Mechanism | Detail |
|---|