Drugs Information: Potassium bicarbonate
Basic Information
|
||
| ID | DDInter1496 | |
| Drug Type | small molecule | |
| Molecular Formula | Chko3 | |
| Molecular Weight | 100.114 | |
| Description | Potassium bicarbonate is an ingredient used as an antacid or to treat hypokalemia. | |
| ATC Classification | A12BA04 | |
| IUPAC Name | Potassium Hydrogen Carbonate | |
| InChI | Inchi=1S/Ch2O3.K/C2-1(3)4;/H(H2,2,3,4);/Q;+1/P-1 | |
| InChI Key | TYJJADVDDVDEDZ-UHFFFAOYSA-M | |
| Canonical SMILES | [K+].OC([O-])=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Potassium bicarbonate
| Severity level | ID | Name | Mechanism | Detail |
|---|