|
| ID |
DDInter15 |
| Drug Type |
small molecule |
| Molecular Formula |
C4H6N4O3S2 |
| Molecular Weight |
222.249
|
| Description |
One of the carbonic anhydrase inhibitors that is sometimes effective against absence seizures. It is sometimes useful also as an adjunct in the treatment of tonic-clonic, myoclonic, and atonic seizures, particularly in women whose seizures occur or are exacerbated at specific times in the menstrual cycle. However, its usefulness is transient often because of rapid development of tolerance. Its antiepileptic effect may be due to its inhibitory effect on brain carbonic anhydrase, which leads to an increased transneuronal chloride gradient, increased chloride current, and increased inhibition. (From Smith and Reynard, Textbook of Pharmacology, 1991, p337)
|
| ATC Classification |
G01AE10
S01EC01
|
| IUPAC Name |
N-(5-Sulfamoyl-1,3,4-Thiadiazol-2-Yl)Acetamide |
| InChI |
Inchi=1S/C4H6N4O3S2/C1-2(9)6-3-7-8-4(12-3)13(5,10)11/H1H3,(H2,5,10,11)(H,6,7,9) |
| InChI Key |
BZKPWHYZMXOIDC-UHFFFAOYSA-N |
| Canonical SMILES |
CC(=O)NC1=NN=C(S1)S(N)(=O)=O |
| Useful Links |
DrugBank
ChEMBL
|