Drugs Information: Azelaic acid
Basic Information
|
||
ID | DDInter151 | |
Drug Type | small molecule | |
Molecular Formula | C9H16O4 | |
Molecular Weight | 188.223 | |
Description | Azelaic acid is a saturated dicarboxylic acid used to treat mild to moderate acne vulgaris. | |
ATC Classification | D10AX03 | |
IUPAC Name | Nonanedioic Acid | |
InChI | Inchi=1S/C9H16O4/C10-8(11)6-4-2-1-3-5-7-9(12)13/H1-7H2,(H,10,11)(H,12,13) | |
InChI Key | BDJRBEYXGGNYIS-UHFFFAOYSA-N | |
Canonical SMILES | OC(=O)CCCCCCCC(O)=O | |
Useful Links | DrugBank ChEMBL PubChem |
Interactions with Azelaic acid
Severity level | ID | Name | Mechanism | Detail |
---|