Drugs Information: Prednisone
Basic Information
|
||
| ID | DDInter1515 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H26O5 | |
| Molecular Weight | 358.434 | |
| Description | Prednisone is a corticosteroid used to treat inflammation or immune-mediated reactions and to treat endocrine or neoplastic diseases. | |
| ATC Classification | A07EA03 H02AB07 | |
| IUPAC Name | (1S,2R,10S,11S,14R,15S)-14-Hydroxy-14-(2-Hydroxyacetyl)-2,15-Dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]Heptadeca-3,6-Diene-5,17-Dione | |
| InChI | Inchi=1S/C21H26O5/C1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/H5,7,9,14-15,18,22,26H,3-4,6,8,10-11H2,1-2H3/T14-,15-,18+,19-,20-,21-/M0/S1 | |
| InChI Key | XOFYZVNMUHMLCC-ZPOLXVRWSA-N | |
| Canonical SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@]12C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Prednisone
| Severity level | ID | Name | Mechanism | Detail |
|---|