Drugs Information: Azelaic acid (topical)
Basic Information
|
||
| ID | DDInter152 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H16O4 | |
| Molecular Weight | 188.223 | |
| Description | Azelaic acid is a saturated dicarboxylic acid used to treat mild to moderate acne vulgaris. | |
| ATC Classification | D10AX03 | |
| IUPAC Name | Nonanedioic Acid | |
| InChI | Inchi=1S/C9H16O4/C10-8(11)6-4-2-1-3-5-7-9(12)13/H1-7H2,(H,10,11)(H,12,13) | |
| InChI Key | BDJRBEYXGGNYIS-UHFFFAOYSA-N | |
| Canonical SMILES | OC(=O)CCCCCCCC(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Azelaic acid (topical)
| Severity level | ID | Name | Mechanism | Detail |
|---|