Drugs Information: Proguanil
Basic Information
|
||
| ID | DDInter1531 | |
| Drug Type | small molecule | |
| Molecular Formula | C11H16Cln5 | |
| Molecular Weight | 253.737 | |
| Description | Proguanil is a medication indicated for prophylaxis and treatment of Plasmodium falciparum malaria. | |
| ATC Classification | P01BB01 P01BB51 | |
| IUPAC Name | 1-[N'-(4-Chlorophenyl)Carbamimidamido]-N-(Propan-2-Yl)Methanimidamide | |
| InChI | Inchi=1S/C11H16Cln5/C1-7(2)15-10(13)17-11(14)16-9-5-3-8(12)4-6-9/H3-7H,1-2H3,(H5,13,14,15,16,17) | |
| InChI Key | SSOLNOMRVKKSON-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)NC(=N)NC(=N)NC1=CC=C(Cl)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Proguanil
| Severity level | ID | Name | Mechanism | Detail |
|---|