Drugs Information: Pyrazinamide
Basic Information
|
||
| ID | DDInter1547 | |
| Drug Type | small molecule | |
| Molecular Formula | C5H5N3O | |
| Molecular Weight | 123.115 | |
| Description | Pyrazinamide is an antituberculosis agent used as a component of tuberculosis (TB) treatment. | |
| ATC Classification | J04AK01 J04AM06 J04AM05 | |
| IUPAC Name | Pyrazine-2-Carboxamide | |
| InChI | Inchi=1S/C5H5N3O/C6-5(9)4-3-7-1-2-8-4/H1-3H,(H2,6,9) | |
| InChI Key | IPEHBUMCGVEMRF-UHFFFAOYSA-N | |
| Canonical SMILES | NC(=O)C1=NC=CN=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Pyrazinamide
| Severity level | ID | Name | Mechanism | Detail |
|---|