Drugs Information: Pyridoxine
Basic Information
|
||
| ID | DDInter1549 | |
| Drug Type | small molecule | |
| Molecular Formula | C8H11No3 | |
| Molecular Weight | 169.180 | |
| Description | Pyridoxine is a vitamin used to correct vitamin B6 deficiency and to treat nausea during pregnancy. | |
| ATC Classification | J04AM08 A11HA02 | |
| IUPAC Name | 4,5-Bis(Hydroxymethyl)-2-Methylpyridin-3-Ol | |
| InChI | Inchi=1S/C8H11No3/C1-5-8(12)7(4-11)6(3-10)2-9-5/H2,10-12H,3-4H2,1H3 | |
| InChI Key | LXNHXLLTXMVWPM-UHFFFAOYSA-N | |
| Canonical SMILES | CC1=C(O)C(CO)=C(CO)C=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Pyridoxine
| Severity level | ID | Name | Mechanism | Detail |
|---|