Drugs Information: Quinidine
Basic Information
|
|
||
| ID | DDInter1556 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H24N2O2 | |
| Molecular Weight | 324.424 | |
| Description | Quinidine is a medication used to restore normal sinus rhythm, treat atrial fibrillation and flutter, and treat ventricular arrhythmias. | |
| ATC Classification | C01BA01 C01BA51 C01BA71 | |
| IUPAC Name | (S)-[(2R,4S,5R)-5-Ethenyl-1-Azabicyclo[2.2.2]Octan-2-Yl](6-Methoxyquinolin-4-Yl)Methanol | |
| InChI | Inchi=1S/C20H24N2O2/C1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/H3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/T13-,14-,19+,20-/M0/S1 | |
| InChI Key | LOUPRKONTZGTKE-LHHVKLHASA-N | |
| Canonical SMILES | [H][C@@]12CCN(C[C@@H]1C=C)[C@]([H])(C2)[C@@H](O)C1=C2C=C(OC)C=CC2=NC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Quinidine
| Severity level | ID | Name | Mechanism | Detail |
|---|