Drugs Information: Ribociclib
Basic Information
|
||
| ID | DDInter1588 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H30N8O | |
| Molecular Weight | 434.548 | |
| Description | Ribociclib is a kinase inhibitor used to treat HR+, HER2- advanced or metastatic breast cancer. | |
| ATC Classification | L01XE42 | |
| IUPAC Name | 7-Cyclopentyl-N,N-Dimethyl-2-{[5-(Piperazin-1-Yl)Pyridin-2-Yl]Amino}-7H-Pyrrolo[2,3-D]Pyrimidine-6-Carboxamide | |
| InChI | Inchi=1S/C23H30N8O/C1-29(2)22(32)19-13-16-14-26-23(28-21(16)31(19)17-5-3-4-6-17)27-20-8-7-18(15-25-20)30-11-9-24-10-12-30/H7-8,13-15,17,24H,3-6,9-12H2,1-2H3,(H,25,26,27,28) | |
| InChI Key | RHXHGRAEPCAFML-UHFFFAOYSA-N | |
| Canonical SMILES | CN(C)C(=O)C1=CC2=CN=C(NC3=CC=C(C=N3)N3CCNCC3)N=C2N1C1CCCC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Ribociclib
| Severity level | ID | Name | Mechanism | Detail |
|---|