Drugs Information: Acetohexamide
Basic Information
|
||
| ID | DDInter16 | |
| Drug Type | small molecule | |
| Molecular Formula | C15H20N2O4S | |
| Molecular Weight | 324.401 | |
| Description | A sulfonylurea hypoglycemic agent that is metabolized in the liver to 1-hydrohexamide. Acetohexamide has been discontinued in the US market. | |
| ATC Classification | A10BB31 | |
| IUPAC Name | 3-(4-Acetylbenzenesulfonyl)-1-Cyclohexylurea | |
| InChI | Inchi=1S/C15H20N2O4S/C1-11(18)12-7-9-14(10-8-12)22(20,21)17-15(19)16-13-5-3-2-4-6-13/H7-10,13H,2-6H2,1H3,(H2,16,17,19) | |
| InChI Key | VGZSUPCWNCWDAN-UHFFFAOYSA-N | |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC1CCCCC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Acetohexamide
| Severity level | ID | Name | Mechanism | Detail |
|---|