Drugs Information: Risedronic acid
Basic Information
|
||
| ID | DDInter1604 | |
| Drug Type | small molecule | |
| Molecular Formula | C7H11No7P2 | |
| Molecular Weight | 283.113 | |
| Description | Risedronic acid is a bisphosphonate used to treat osteoporosis and Paget's disease. | |
| ATC Classification | M05BB07 M05BB02 M05BB04 M05BA07 | |
| IUPAC Name | [1-Hydroxy-1-Phosphono-2-(Pyridin-3-Yl)Ethyl]Phosphonic Acid | |
| InChI | Inchi=1S/C7H11No7P2/C9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6/H1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15) | |
| InChI Key | IIDJRNMFWXDHID-UHFFFAOYSA-N | |
| Canonical SMILES | OC(CC1=CN=CC=C1)(P(O)(O)=O)P(O)(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Risedronic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|