Drugs Information: Sacubitril
Basic Information
|
||
| ID | DDInter1630 | |
| Drug Type | small molecule | |
| Molecular Formula | C24H29No5 | |
| Molecular Weight | 411.498 | |
| Description | Sacubitril is a neprilysin inhibitor used in combination with valsartan as an adjunct to reduce the risk of cardiovascular death and hospitalization for heart failure in patients with chronic heart failure (NYHA Class II-IV) and reduced ejection fraction. | |
| ATC Classification | C09DX04 | |
| IUPAC Name | 3-{[(2S,4R)-1-{[1,1'-Biphenyl]-4-Yl}-5-Ethoxy-4-Methyl-5-Oxopentan-2-Yl]Carbamoyl}Propanoic Acid | |
| InChI | Inchi=1S/C24H29No5/C1-3-30-24(29)17(2)15-21(25-22(26)13-14-23(27)28)16-18-9-11-20(12-10-18)19-7-5-4-6-8-19/H4-12,17,21H,3,13-16H2,1-2H3,(H,25,26)(H,27,28)/T17-,21+/M1/S1 | |
| InChI Key | PYNXFZCZUAOOQC-UTKZUKDTSA-N | |
| Canonical SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C1=CC=CC=C1)NC(=O)CCC(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Sacubitril
| Severity level | ID | Name | Mechanism | Detail |
|---|