Drugs Information: Safinamide
Basic Information
|
||
| ID | DDInter1631 | |
| Drug Type | small molecule | |
| Molecular Formula | C17H19Fn2O2 | |
| Molecular Weight | 302.349 | |
| Description | Safinamide is a MAO-B inhibitor used as an add-on treatment to levodopa/carbidopa for Parkinson's disease during "off" episodes. | |
| ATC Classification | N04BD03 | |
| IUPAC Name | (2S)-2-[({4-[(3-Fluorophenyl)Methoxy]Phenyl}Methyl)Amino]Propanamide | |
| InChI | Inchi=1S/C17H19Fn2O2/C1-12(17(19)21)20-10-13-5-7-16(8-6-13)22-11-14-3-2-4-15(18)9-14/H2-9,12,20H,10-11H2,1H3,(H2,19,21)/T12-/M0/S1 | |
| InChI Key | NEMGRZFTLSKBAP-LBPRGKRZSA-N | |
| Canonical SMILES | C[C@H](NCC1=CC=C(OCC2=CC(F)=CC=C2)C=C1)C(N)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Safinamide
| Severity level | ID | Name | Mechanism | Detail |
|---|