Drugs Information: Salicylic acid (sodium)
Basic Information
|
|
||
| ID | DDInter1633 | |
| Drug Type | small molecule | |
| Molecular Formula | C7H6O3 | |
| Molecular Weight | 138.122 | |
| Description | Salicylic acid is an acid used to treat acne, psoriasis, calluses, corns, keratosis pilaris, and warts. | |
| ATC Classification | D01AE12 N02BA04 N02BA12 S01BC08 | |
| IUPAC Name | 2-Hydroxybenzoic Acid | |
| InChI | Inchi=1S/C7H6O3/C8-6-4-2-1-3-5(6)7(9)10/H1-4,8H,(H,9,10) | |
| InChI Key | YGSDEFSMJLZEOE-UHFFFAOYSA-N | |
| Canonical SMILES | OC(=O)C1=CC=CC=C1O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Salicylic acid (sodium)
| Severity level | ID | Name | Mechanism | Detail |
|---|