Drugs Information: Saquinavir
Basic Information
|
||
| ID | DDInter1640 | |
| Drug Type | small molecule | |
| Molecular Formula | C38H50N6O5 | |
| Molecular Weight | 670.855 | |
| Description | Saquinavir is an HIV protease inhibitor used in combination with other antiretroviral agents for the treatment of HIV-1 with advanced immunodeficiency. | |
| ATC Classification | J05AE01 | |
| IUPAC Name | (2S)-N-[(2S,3R)-4-[(3S,4As,8As)-3-(Tert-Butylcarbamoyl)-Decahydroisoquinolin-2-Yl]-3-Hydroxy-1-Phenylbutan-2-Yl]-2-[(Quinolin-2- | |
| InChI | Inchi=1S/C38H50N6O5/C1-38(2,3)43-37(49)32-20-26-14-7-8-15-27(26)22-44(32)23-33(45)30(19-24-11-5-4-6-12-24)41-36(48)31(21-34(39)46)42-35(47)29-18-17-25-13-9-10-16-28(25)40-29/H4-6,9-13,16-18,26-27,30-33,45H,7-8,14-15,19-23H2,1-3H3,(H2,39,46)(H,41,48)(H,42,47)(H,43,49)/T26-,27+,30-,31-,32-,33+/M0/S1 | |
| InChI Key | QWAXKHKRTORLEM-UGJKXSETSA-N | |
| Canonical SMILES | [H][C@@]12CCCC[C@]1([H])CN(C[C@@H](O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(N)=O)NC(=O)C1=NC3=C(C=CC=C3)C=C1)[C@@H](C2)C(=O)NC(C)(C)C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Saquinavir
| Severity level | ID | Name | Mechanism | Detail |
|---|