Drugs Information: Saxagliptin
Basic Information
|
||
| ID | DDInter1646 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H25N3O2 | |
| Molecular Weight | 315.417 | |
| Description | Saxagliptin is an DPP-4 inhibitor used for the management of type 2 diabetes mellitus. | |
| ATC Classification | A10BD21 A10BD25 A10BH03 A10BD10 | |
| IUPAC Name | (1S,3S,5S)-2-[(2S)-2-Amino-2-(3-Hydroxyadamantan-1-Yl)Acetyl]-2-Azabicyclo[3.1.0]Hexane-3-Carbonitrile | |
| InChI | Inchi=1S/C18H25N3O2/C19-8-13-2-12-3-14(12)21(13)16(22)15(20)17-4-10-1-11(5-17)7-18(23,6-10)9-17/H10-15,23H,1-7,9,20H2/T10?,11?,12-,13+,14+,15-,17?,18?/M1/S1 | |
| InChI Key | QGJUIPDUBHWZPV-SGTAVMJGSA-N | |
| Canonical SMILES | [H][C@@]12C[C@]1([H])N([C@@H](C2)C#N)C(=O)[C@@H](N)C12CC3CC(CC(O)(C3)C1)C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Saxagliptin
| Severity level | ID | Name | Mechanism | Detail |
|---|