Drugs Information: Baricitinib
Basic Information
|
||
| ID | DDInter165 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H17N7O2S | |
| Molecular Weight | 371.425 | |
| Description | Baricitinib is a Janus kinase inhibitor used to treat moderate to severe rheumatoid arthritis that has responded poorly to at least one TNF antagonist. | |
| ATC Classification | L04AA37 | |
| IUPAC Name | 2-[1-(Ethanesulfonyl)-3-(4-{7H-Pyrrolo[2,3-D]Pyrimidin-4-Yl}-1H-Pyrazol-1-Yl)Azetidin-3-Yl]Acetonitrile | |
| InChI | Inchi=1S/C16H17N7O2S/C1-2-26(24,25)22-9-16(10-22,4-5-17)23-8-12(7-21-23)14-13-3-6-18-15(13)20-11-19-14/H3,6-8,11H,2,4,9-10H2,1H3,(H,18,19,20) | |
| InChI Key | XUZMWHLSFXCVMG-UHFFFAOYSA-N | |
| Canonical SMILES | CCS(=O)(=O)N1CC(CC#N)(C1)N1C=C(C=N1)C1=C2C=CNC2=NC=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Baricitinib
| Severity level | ID | Name | Mechanism | Detail |
|---|