Drugs Information: Selexipag
Basic Information
|
||
| ID | DDInter1656 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H32N4O4S | |
| Molecular Weight | 496.632 | |
| Description | Selexipag is a non prostanoid IP prostacyclin receptor agonist used to treat pulmonary arterial hypertension. | |
| ATC Classification | B01AC27 | |
| IUPAC Name | 2-{4-[(5,6-Diphenylpyrazin-2-Yl)(Propan-2-Yl)Amino]Butoxy}-N-Methanesulfonylacetamide | |
| InChI | Inchi=1S/C26H32N4O4S/C1-20(2)30(16-10-11-17-34-19-24(31)29-35(3,32)33)23-18-27-25(21-12-6-4-7-13-21)26(28-23)22-14-8-5-9-15-22/H4-9,12-15,18,20H,10-11,16-17,19H2,1-3H3,(H,29,31) | |
| InChI Key | QXWZQTURMXZVHJ-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)N(CCCCOCC(=O)NS(C)(=O)=O)C1=NC(C2=CC=CC=C2)=C(N=C1)C1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Selexipag
| Severity level | ID | Name | Mechanism | Detail |
|---|