Drugs Information: Silodosin
Basic Information
|
||
| ID | DDInter1667 | |
| Drug Type | small molecule | |
| Molecular Formula | C25H32F3N3O4 | |
| Molecular Weight | 495.542 | |
| Description | Silodosin is an alpha-1 adrenergic receptor antagonist used to treat symptoms associated with benign prostatic hyperplasia (BPH). | |
| ATC Classification | G04CA04 | |
| IUPAC Name | 1-(3-Hydroxypropyl)-5-[(2R)-2-({2-[2-(2,2,2-Trifluoroethoxy)Phenoxy]Ethyl}Amino)Propyl]-2,3-Dihydro-1H-Indole-7-Carboxamide | |
| InChI | Inchi=1S/C25H32F3N3O4/C1-17(30-8-12-34-21-5-2-3-6-22(21)35-16-25(26,27)28)13-18-14-19-7-10-31(9-4-11-32)23(19)20(15-18)24(29)33/H2-3,5-6,14-15,17,30,32H,4,7-13,16H2,1H3,(H2,29,33)/T17-/M1/S1 | |
| InChI Key | PNCPYILNMDWPEY-QGZVFWFLSA-N | |
| Canonical SMILES | C[C@H](CC1=CC2=C(N(CCCO)CC2)C(=C1)C(N)=O)NCCOC1=CC=CC=C1OCC(F)(F)F | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Silodosin
| Severity level | ID | Name | Mechanism | Detail |
|---|