Drugs Information: Simethicone
Basic Information
|
||
| ID | DDInter1674 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H18O4Si3 | |
| Molecular Weight | 238.461 | |
| Description | Simethicone is an anti-flatulence agent used to relieve pressure, bloating, and symptoms referred to as gas. | |
| ATC Classification | - | |
| IUPAC Name | 3,3,5,5-Tetramethyl-2,4-Dioxa-3,5-Disilahexane; Silanedione | |
| InChI | Inchi=1S/C6H18O2Si2.O2Si/C1-7-10(5,6)8-9(2,3)4;1-3-2/H1-6H3; | |
| InChI Key | AMTWCFIAVKBGOD-UHFFFAOYSA-N | |
| Canonical SMILES | O=[Si]=O.CO[Si](C)(C)O[Si](C)(C)C | |
| Useful Links | DrugBank | |
Interactions with Simethicone
| Severity level | ID | Name | Mechanism | Detail |
|---|