Drugs Information: Sodium acetate
Basic Information
|
||
| ID | DDInter1681 | |
| Drug Type | small molecule | |
| Molecular Formula | C2H3Nao2 | |
| Molecular Weight | 82.034 | |
| Description | Sodium acetate is a compound used for electrolyte replenishment and total parenteral nutrition (TPN) therapy. | |
| ATC Classification | B05XA08 | |
| IUPAC Name | Sodium Acetate | |
| InChI | Inchi=1S/C2H4O2.Na/C1-2(3)4;/H1H3,(H,3,4);/Q;+1/P-1 | |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M | |
| Canonical SMILES | [Na+].CC([O-])=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Sodium acetate
| Severity level | ID | Name | Mechanism | Detail |
|---|