|
| ID |
DDInter1690 |
| Drug Type |
small molecule |
| Molecular Formula |
C4H7Nao3 |
| Molecular Weight |
126.087
|
| Description |
Sodium oxybate (Xyrem) is a central nervous system depressant used for the treatment of cataplexy and extreme daytime sleepiness (EDS) associated with narcolepsy. It is the sodium salt of gamma hydroxybutyric acid (GHB) which is an endogenous compound and a metabolite of the neurotransmitter GABA. The exact mechanism of action for treating EDS and cataplexy is not known but is is hypothesised that its therapeutic effects are due to GABA(B) effects on noradrenergic, dopaminaergic and thalamocorticol neurons. The drug follows non-linear pharmacokinetics. As it has been associated with misuse/abuse it is strictly controlled and all patients and prescribers must enroll in the sodium oxybate REMs program in order to gain access to the medication.
|
| ATC Classification |
N01AX11
N07XX04
|
| IUPAC Name |
Sodium 4-Hydroxybutanoate |
| InChI |
Inchi=1S/C4H8O3.Na/C5-3-1-2-4(6)7;/H5H,1-3H2,(H,6,7);/Q;+1/P-1 |
| InChI Key |
XYGBKMMCQDZQOZ-UHFFFAOYSA-M |
| Canonical SMILES |
[Na+].OCCCC([O-])=O |
| Useful Links |
DrugBank
ChEMBL
|