Drugs Information: Sofosbuvir
Basic Information
|
||
| ID | DDInter1695 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H29Fn3O9P | |
| Molecular Weight | 529.458 | |
| Description | Sofosbuvir is a direct-acting antiviral agent used to treat specific hepatitis C virus (HCV) infections in combination with other antiviral agents. | |
| ATC Classification | J05AP08 J05AP51 J05AP55 J05AP56 | |
| IUPAC Name | Propan-2-Yl (2S)-2-{[(S)-{[(2R,3R,4R,5R)-5-(2,4-Dioxo-1,2,3,4-Tetrahydropyrimidin-1-Yl)-4-Fluoro-3-Hydroxy-4-Methyloxolan-2-Yl]M | |
| InChI | Inchi=1S/C22H29Fn3O9P/C1-13(2)33-19(29)14(3)25-36(31,35-15-8-6-5-7-9-15)32-12-16-18(28)22(4,23)20(34-16)26-11-10-17(27)24-21(26)30/H5-11,13-14,16,18,20,28H,12H2,1-4H3,(H,25,31)(H,24,27,30)/T14-,16+,18+,20+,22+,36-/M0/S1 | |
| InChI Key | TTZHDVOVKQGIBA-IQWMDFIBSA-N | |
| Canonical SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@H]1O[C@@H](N2C=CC(=O)NC2=O)[C@](C)(F)[C@@H]1O)OC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Sofosbuvir
| Severity level | ID | Name | Mechanism | Detail |
|---|