Drugs Information: Acetohydroxamic acid
Basic Information
|
||
| ID | DDInter17 | |
| Drug Type | small molecule | |
| Molecular Formula | C2H5No2 | |
| Molecular Weight | 75.067 | |
| Description | Acetohydroxamic acid is a synthetic urea derivative used to treat urea splitting bacterial infections of the urinary tract. | |
| ATC Classification | G04BX03 | |
| IUPAC Name | N-Hydroxyacetamide | |
| InChI | Inchi=1S/C2H5No2/C1-2(4)3-5/H5H,1H3,(H,3,4) | |
| InChI Key | RRUDCFGSUDOHDG-UHFFFAOYSA-N | |
| Canonical SMILES | CC(=O)NO | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Acetohydroxamic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|