Drugs Information: Sorafenib
Basic Information
|
||
| ID | DDInter1702 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H16Clf3N4O3 | |
| Molecular Weight | 464.831 | |
| Description | Sorafenib is a kinase inhibitor used in the treatment of unresectable liver carcinoma and advanced renal carcinoma. | |
| ATC Classification | L01XE05 | |
| IUPAC Name | 4-[4-({[4-Chloro-3-(Trifluoromethyl)Phenyl]Carbamoyl}Amino)Phenoxy]-N-Methylpyridine-2-Carboxamide | |
| InChI | Inchi=1S/C21H16Clf3N4O3/C1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/H2-11H,1H3,(H,26,30)(H2,28,29,31) | |
| InChI Key | MLDQJTXFUGDVEO-UHFFFAOYSA-N | |
| Canonical SMILES | CNC(=O)C1=NC=CC(OC2=CC=C(NC(=O)NC3=CC(=C(Cl)C=C3)C(F)(F)F)C=C2)=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Sorafenib
| Severity level | ID | Name | Mechanism | Detail |
|---|