Drugs Information: Streptomycin
Basic Information
|
|
||
| ID | DDInter1713 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H39N7O12 | |
| Molecular Weight | 581.580 | |
| Description | Streptomycin is an aminoglycoside antibiotic indicated to treat multi-drug resistant mycobacterium tuberculosis and various non-tuberculosis infections. | |
| ATC Classification | J04AM01 J01GA01 A07AA54 A07AA04 | |
| IUPAC Name | N-[(1S,2R,3R,4S,5R,6R)-3-Carbamimidamido-6-{[(2R,3R,4R,5S)-3-{[(2S,3S,4S,5R,6S)-4,5-Dihydroxy-6-(Hydroxymethyl)-3-(Methylamino)O | |
| InChI | Inchi=1S/C21H39N7O12/C1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/H4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/T5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+/M0/S1 | |
| InChI Key | UCSJYZPVAKXKNQ-HZYVHMACSA-N | |
| Canonical SMILES | CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@H]1[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](NC(N)=N)[C@@H](O)[C@@H]2NC(N)=N)O[C@@H](C)[C@]1(O)C=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Streptomycin
| Severity level | ID | Name | Mechanism | Detail |
|---|