Drugs Information: Sulfasalazine
Basic Information
|
||
| ID | DDInter1725 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H14N4O5S | |
| Molecular Weight | 398.399 | |
| Description | Sulfasalazine is an anti-inflammatory drug used to treat Crohn's disease and rheumatoid arthritis. | |
| ATC Classification | G01AE10 A07EC01 | |
| IUPAC Name | 2-Hydroxy-5-[(E)-2-{4-[(Pyridin-2-Yl)Sulfamoyl]Phenyl}Diazen-1-Yl]Benzoic Acid | |
| InChI | Inchi=1S/C18H14N4O5S/C23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17/H1-11,23H,(H,19,22)(H,24,25)/B21-20+ | |
| InChI Key | NCEXYHBECQHGNR-QZQOTICOSA-N | |
| Canonical SMILES | OC(=O)C1=CC(=CC=C1O)\N=N\C1=CC=C(C=C1)S(=O)(=O)NC1=NC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Sulfasalazine
| Severity level | ID | Name | Mechanism | Detail |
|---|