Drugs Information: Tafenoquine
Basic Information
|
||
| ID | DDInter1739 | |
| Drug Type | small molecule | |
| Molecular Formula | C24H28F3N3O3 | |
| Molecular Weight | 463.500 | |
| Description | Tafenoquine is an antiparasitic agent used for the treatment and prevention of relapse of Vivax malaria. | |
| ATC Classification | P01BA07 | |
| IUPAC Name | N4-{2,6-Dimethoxy-4-Methyl-5-[3-(Trifluoromethyl)Phenoxy]Quinolin-8-Yl}Pentane-1,4-Diamine | |
| InChI | Inchi=1S/C24H28F3N3O3/C1-14-11-20(32-4)30-22-18(29-15(2)7-6-10-28)13-19(31-3)23(21(14)22)33-17-9-5-8-16(12-17)24(25,26)27/H5,8-9,11-13,15,29H,6-7,10,28H2,1-4H3 | |
| InChI Key | LBHLFPGPEGDCJG-UHFFFAOYSA-N | |
| Canonical SMILES | COC1=CC(C)=C2C(OC3=CC=CC(=C3)C(F)(F)F)=C(OC)C=C(NC(C)CCCN)C2=N1 | |
| Useful Links | DrugBank ChEMBL | |
Interactions with Tafenoquine
| Severity level | ID | Name | Mechanism | Detail |
|---|