Drugs Information: Tafluprost (ophthalmic)
Basic Information
|
||
| ID | DDInter1740 | |
| Drug Type | small molecule | |
| Molecular Formula | C25H34F2O5 | |
| Molecular Weight | 452.538 | |
| Description | Tafluprost is an ophthalmic prostaglandin analog used to lower intraocular pressure in patients with ocular hypertension or open-angle glaucoma. | |
| ATC Classification | S01EE05 | |
| IUPAC Name | Propan-2-Yl (5Z)-7-[(1R,2R,3R,5S)-2-[(1E)-3,3-Difluoro-4-Phenoxybut-1-En-1-Yl]-3,5-Dihydroxycyclopentyl]Hept-5-Enoate | |
| InChI | Inchi=1S/C25H34F2O5/C1-18(2)32-24(30)13-9-4-3-8-12-20-21(23(29)16-22(20)28)14-15-25(26,27)17-31-19-10-6-5-7-11-19/H3,5-8,10-11,14-15,18,20-23,28-29H,4,9,12-13,16-17H2,1-2H3/B8-3-,15-14+/T20-,21-,22+,23-/M1/S1 | |
| InChI Key | WSNODXPBBALQOF-VEJSHDCNSA-N | |
| Canonical SMILES | CC(C)OC(=O)CCC\C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\C(F)(F)COC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tafluprost (ophthalmic)
| Severity level | ID | Name | Mechanism | Detail |
|---|