Drugs Information: Tegaserod
Basic Information
|
||
| ID | DDInter1754 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H23N5O | |
| Molecular Weight | 301.394 | |
| Description | Tegaserod is a serotonin-4 (5-HT4) receptor agonist indicated for the treatment of constipation predominant irritable bowel syndrome (IBS-C) specifically in women under the age of 65. There is currently no safety or efficacy data for use of tegaserol in men. | |
| ATC Classification | A06AX06 | |
| IUPAC Name | N'-[(E)-[(5-Methoxy-1H-Indol-3-Yl)Methylidene]Amino]-N-Pentylguanidine | |
| InChI | Inchi=1S/C16H23N5O/C1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15/H6-7,9-11,19H,3-5,8H2,1-2H3,(H3,17,18,21)/B20-11+ | |
| InChI Key | IKBKZGMPCYNSLU-RGVLZGJSSA-N | |
| Canonical SMILES | CCCCCNC(=N)N\N=C\C1=CNC2=C1C=C(OC)C=C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tegaserod
| Severity level | ID | Name | Mechanism | Detail |
|---|