Drugs Information: Telaprevir
Basic Information
|
||
| ID | DDInter1755 | |
| Drug Type | small molecule | |
| Molecular Formula | C36H53N7O6 | |
| Molecular Weight | 679.863 | |
| Description | Telaprevir is an NS3/4A viral protease inhibitor used in combination with other antivirals for the curative treatment of chronic Hepatitis C Virus infections. | |
| ATC Classification | J05AP02 | |
| IUPAC Name | (3S)-3-{[(1S,3Ar,6As)-2-[(2S)-2-[(2S)-2-Cyclohexyl-2-(Pyrazin-2-Ylformamido)Acetamido]-3,3-Dimethylbutanoyl]-Octahydrocyclopenta | |
| InChI | Inchi=1S/C36H53N7O6/C1-5-10-25(29(44)34(48)39-23-15-16-23)40-33(47)28-24-14-9-13-22(24)20-43(28)35(49)30(36(2,3)4)42-32(46)27(21-11-7-6-8-12-21)41-31(45)26-19-37-17-18-38-26/H17-19,21-25,27-28,30H,5-16,20H2,1-4H3,(H,39,48)(H,40,47)(H,41,45)(H,42,46)/T22-,24-,25-,27-,28-,30+/M0/S1 | |
| InChI Key | BBAWEDCPNXPBQM-GDEBMMAJSA-N | |
| Canonical SMILES | [H][C@@]12CCC[C@]1([H])[C@H](N(C2)C(=O)[C@@H](NC(=O)[C@@H](NC(=O)C1=NC=CN=C1)C1CCCCC1)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)C(=O)NC1CC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Telaprevir
| Severity level | ID | Name | Mechanism | Detail |
|---|