Drugs Information: Bempedoic acid
Basic Information
|
||
| ID | DDInter176 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H36O5 | |
| Molecular Weight | 344.492 | |
| Description | Bempedoic acid is a drug used in conjunction with lifestyle modification and/or other agents for the treatment of refractory hypercholesterolemia. | |
| ATC Classification | C10AX15 | |
| IUPAC Name | 8-Hydroxy-2,2,14,14-Tetramethylpentadecanedioic Acid | |
| InChI | Inchi=1S/C19H36O5/C1-18(2,16(21)22)13-9-5-7-11-15(20)12-8-6-10-14-19(3,4)17(23)24/H15,20H,5-14H2,1-4H3,(H,21,22)(H,23,24) | |
| InChI Key | HYHMLYSLQUKXKP-UHFFFAOYSA-N | |
| Canonical SMILES | CC(C)(CCCCCC(O)CCCCCC(C)(C)C(O)=O)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Bempedoic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|