Drugs Information: Testosterone (topical)
Basic Information
|
||
| ID | DDInter1776 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H28O2 | |
| Molecular Weight | 288.431 | |
| Description | Testosterone is a hormone used to treat hypogonadism, breast carcinoma in women, or the vasomotor symptoms of menopause. | |
| ATC Classification | G03BA03 G03EA02 | |
| IUPAC Name | (1S,3As,3Br,9Ar,9Bs,11As)-1-Hydroxy-9A,11A-Dimethyl-1H,2H,3H,3Ah,3Bh,4H,5H,7H,8H,9H,9Ah,9Bh,10H,11H,11Ah-Cyclopenta[A]Phenanthre | |
| InChI | Inchi=1S/C19H28O2/C1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/H11,14-17,21H,3-10H2,1-2H3/T14-,15-,16-,17-,18-,19-/M0/S1 | |
| InChI Key | MUMGGOZAMZWBJJ-DYKIIFRCSA-N | |
| Canonical SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Testosterone (topical)
| Severity level | ID | Name | Mechanism | Detail |
|---|