Drugs Information: Tiludronic acid
Basic Information
|
||
| ID | DDInter1808 | |
| Drug Type | small molecule | |
| Molecular Formula | C7H9Clo6P2S | |
| Molecular Weight | 318.610 | |
| Description | Tiludronic acid is a bisphosphonate used for the treatment of Paget's disease of bone. | |
| ATC Classification | M05BA05 | |
| IUPAC Name | {[(4-Chlorophenyl)Sulfanyl](Phosphono)Methyl}Phosphonic Acid | |
| InChI | Inchi=1S/C7H9Clo6P2S/C8-5-1-3-6(4-2-5)17-7(15(9,10)11)16(12,13)14/H1-4,7H,(H2,9,10,11)(H2,12,13,14) | |
| InChI Key | DKJJVAGXPKPDRL-UHFFFAOYSA-N | |
| Canonical SMILES | OP(O)(=O)C(SC1=CC=C(Cl)C=C1)P(O)(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tiludronic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|