Drugs Information: Tirofiban
Basic Information
|
|
||
| ID | DDInter1818 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H36N2O5S | |
| Molecular Weight | 440.605 | |
| Description | Tirofiban is a platelet aggregation inhibitor used to prevent thrombotic events in non-ST elevated acute coronary syndrome. | |
| ATC Classification | B01AC17 | |
| IUPAC Name | (2S)-2-(Butane-1-Sulfonamido)-3-{4-[4-(Piperidin-4-Yl)Butoxy]Phenyl}Propanoic Acid | |
| InChI | Inchi=1S/C22H36N2O5S/C1-2-3-16-30(27,28)24-21(22(25)26)17-19-7-9-20(10-8-19)29-15-5-4-6-18-11-13-23-14-12-18/H7-10,18,21,23-24H,2-6,11-17H2,1H3,(H,25,26)/T21-/M0/S1 | |
| InChI Key | COKMIXFXJJXBQG-NRFANRHFSA-N | |
| Canonical SMILES | CCCCS(=O)(=O)N[C@@H](CC1=CC=C(OCCCCC2CCNCC2)C=C1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tirofiban
| Severity level | ID | Name | Mechanism | Detail |
|---|