Drugs Information: Tofacitinib
Basic Information
|
|
||
| ID | DDInter1825 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H20N6O | |
| Molecular Weight | 312.377 | |
| Description | Tofacitinib is a Janus kinase (JAK) inhibitor used to treat rheumatoid and psoriatic arthritis, and ulcerative colitis. It is not recommended to be combined with biologic therapies or potent immunosuppressants like cyclosporine or azathioprine. | |
| ATC Classification | L04AA29 | |
| IUPAC Name | 3-[(3R,4R)-4-Methyl-3-[Methyl({7H-Pyrrolo[2,3-D]Pyrimidin-4-Yl})Amino]Piperidin-1-Yl]-3-Oxopropanenitrile | |
| InChI | Inchi=1S/C16H20N6O/C1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16/H4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20)/T11-,13+/M1/S1 | |
| InChI Key | UJLAWZDWDVHWOW-YPMHNXCESA-N | |
| Canonical SMILES | C[C@@H]1CCN(C[C@@H]1N(C)C1=NC=NC2=C1C=CN2)C(=O)CC#N | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tofacitinib
| Severity level | ID | Name | Mechanism | Detail |
|---|