Drugs Information: Tolazamide
Basic Information
|
||
| ID | DDInter1826 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H21N3O3S | |
| Molecular Weight | 311.406 | |
| Description | Tolazamide is a sulfonylurea used in the treatment of non insulin dependent diabetes mellitus. | |
| ATC Classification | A10BB05 | |
| IUPAC Name | 1-(Azepan-1-Yl)-3-(4-Methylbenzenesulfonyl)Urea | |
| InChI | Inchi=1S/C14H21N3O3S/C1-12-6-8-13(9-7-12)21(19,20)16-14(18)15-17-10-4-2-3-5-11-17/H6-9H,2-5,10-11H2,1H3,(H2,15,16,18) | |
| InChI Key | OUDSBRTVNLOZBN-UHFFFAOYSA-N | |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NN1CCCCCC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tolazamide
| Severity level | ID | Name | Mechanism | Detail |
|---|