Drugs Information: Tolbutamide
Basic Information
|
||
| ID | DDInter1828 | |
| Drug Type | small molecule | |
| Molecular Formula | C12H18N2O3S | |
| Molecular Weight | 270.353 | |
| Description | Tolbutamide is a sulfonylurea used to treat hyperglycemia in patients with type 2 diabetes mellitus. | |
| ATC Classification | V04CA01 A10BB03 | |
| IUPAC Name | 3-Butyl-1-(4-Methylbenzenesulfonyl)Urea | |
| InChI | Inchi=1S/C12H18N2O3S/C1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/H5-8H,3-4,9H2,1-2H3,(H2,13,14,15) | |
| InChI Key | JLRGJRBPOGGCBT-UHFFFAOYSA-N | |
| Canonical SMILES | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tolbutamide
| Severity level | ID | Name | Mechanism | Detail |
|---|