Drugs Information: Tolvaptan
Basic Information
|
||
| ID | DDInter1833 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H25Cln2O3 | |
| Molecular Weight | 448.950 | |
| Description | Tolvaptan is a selective vasopressin V2-receptor antagonist to slow kidney function decline in patients at risk for rapidly progressing autosomal dominant polycystic kidney disease (ADPKD). Also used to treat hypervolemic and euvolemic hyponatremia. | |
| ATC Classification | C03XA01 | |
| IUPAC Name | N-{4-[(5R)-7-Chloro-5-Hydroxy-2,3,4,5-Tetrahydro-1H-1-Benzazepine-1-Carbonyl]-3-Methylphenyl}-2-Methylbenzamide | |
| InChI | Inchi=1S/C26H25Cln2O3/C1-16-6-3-4-7-20(16)25(31)28-19-10-11-21(17(2)14-19)26(32)29-13-5-8-24(30)22-15-18(27)9-12-23(22)29/H3-4,6-7,9-12,14-15,24,30H,5,8,13H2,1-2H3,(H,28,31)/T24-/M1/S1 | |
| InChI Key | GYHCTFXIZSNGJT-XMMPIXPASA-N | |
| Canonical SMILES | CC1=CC=CC=C1C(=O)NC1=CC(C)=C(C=C1)C(=O)N1CCC[C@@H](O)C2=C1C=CC(Cl)=C2 | |
| Useful Links | DrugBank PubChem | |
Interactions with Tolvaptan
| Severity level | ID | Name | Mechanism | Detail |
|---|