Drugs Information: Trandolapril
Basic Information
|
||
| ID | DDInter1843 | |
| Drug Type | small molecule | |
| Molecular Formula | C24H34N2O5 | |
| Molecular Weight | 430.545 | |
| Description | Trandolapril is a prodrug of an ACE inhibitor used to treat hypertension, congestive heart failure, and to improve survival following a myocardial infarction. | |
| ATC Classification | C09AA10 C09BB10 | |
| IUPAC Name | (2S,3Ar,7As)-1-[(2S)-2-{[(2S)-1-Ethoxy-1-Oxo-4-Phenylbutan-2-Yl]Amino}Propanoyl]-Octahydro-1H-Indole-2-Carboxylic Acid | |
| InChI | Inchi=1S/C24H34N2O5/C1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29/H4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29)/T16-,18+,19-,20-,21-/M0/S1 | |
| InChI Key | VXFJYXUZANRPDJ-WTNASJBWSA-N | |
| Canonical SMILES | [H][C@@]12C[C@H](N(C(=O)[C@H](C)N[C@@H](CCC3=CC=CC=C3)C(=O)OCC)[C@@]1([H])CCCC2)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Trandolapril
| Severity level | ID | Name | Mechanism | Detail |
|---|