Drugs Information: Travoprost
Basic Information
|
||
| ID | DDInter1849 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H35F3O6 | |
| Molecular Weight | 500.554 | |
| Description | Travoprost is a prostaglandin analog used in the treatment of elevated intraocular pressure due to open angle glaucoma or ocular hypertension. | |
| ATC Classification | S01EE04 | |
| IUPAC Name | Propan-2-Yl (5Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(1E,3R)-3-Hydroxy-4-[3-(Trifluoromethyl)Phenoxy]But-1-En-1-Yl]Cyclopentyl]Hep | |
| InChI | Inchi=1S/C26H35F3O6/C1-17(2)35-25(33)11-6-4-3-5-10-21-22(24(32)15-23(21)31)13-12-19(30)16-34-20-9-7-8-18(14-20)26(27,28)29/H3,5,7-9,12-14,17,19,21-24,30-32H,4,6,10-11,15-16H2,1-2H3/B5-3-,13-12+/T19-,21-,22-,23+,24-/M1/S1 | |
| InChI Key | MKPLKVHSHYCHOC-AHTXBMBWSA-N | |
| Canonical SMILES | CC(C)OC(=O)CCC\C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\[C@@H](O)COC1=CC=CC(=C1)C(F)(F)F | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Travoprost
| Severity level | ID | Name | Mechanism | Detail |
|---|