Drugs Information: Trimethadione
Basic Information
|
||
| ID | DDInter1871 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H9No3 | |
| Molecular Weight | 143.142 | |
| Description | Trimethadione is an anticonvulsant agent indicated for the control of treatment-refractory petit mal seizures. | |
| ATC Classification | N03AC02 | |
| IUPAC Name | Trimethyl-1,3-Oxazolidine-2,4-Dione | |
| InChI | Inchi=1S/C6H9No3/C1-6(2)4(8)7(3)5(9)10-6/H1-3H3 | |
| InChI Key | IRYJRGCIQBGHIV-UHFFFAOYSA-N | |
| Canonical SMILES | CN1C(=O)OC(C)(C)C1=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Trimethadione
| Severity level | ID | Name | Mechanism | Detail |
|---|