|
| ID |
DDInter188 |
| Drug Type |
small molecule |
| Molecular Formula |
C15H14Cln3O4S3 |
| Molecular Weight |
431.945
|
| Description |
Benzthiazide is used to treat hypertension and edema. Like other thiazides, benzthiazide promotes water loss from the body (diuretics). They inhibit Na+/Cl- reabsorption from the distal convoluted tubules in the kidneys. Thiazides also cause loss of potassium and an increase in serum uric acid. Thiazides are often used to treat hypertension, but their hypotensive effects are not necessarily due to their diuretic activity. Thiazides have been shown to prevent hypertension-related morbidity and mortality although the mechanism is not fully understood. Thiazides cause vasodilation by activating calcium-activated potassium channels (large conductance) in vascular smooth muscles and inhibiting various carbonic anhydrases in vascular tissue.
|
| ATC Classification |
G01AE10
|
| IUPAC Name |
3-[(Benzylsulfanyl)Methyl]-6-Chloro-1,1-Dioxo-4H-1Lambda6,2,4-Benzothiadiazine-7-Sulfonamide |
| InChI |
Inchi=1S/C15H14Cln3O4S3/C16-11-6-12-14(7-13(11)25(17,20)21)26(22,23)19-15(18-12)9-24-8-10-4-2-1-3-5-10/H1-7H,8-9H2,(H,18,19)(H2,17,20,21) |
| InChI Key |
NDTSRXAMMQDVSW-UHFFFAOYSA-N |
| Canonical SMILES |
NS(=O)(=O)C1=CC2=C(C=C1Cl)N=C(CSCC1=CC=CC=C1)NS2(=O)=O |
| Useful Links |
DrugBank
ChEMBL
PubChem
|