Drugs Information: Tryptophan
Basic Information
|
||
| ID | DDInter1888 | |
| Drug Type | small molecule | |
| Molecular Formula | C11H12N2O2 | |
| Molecular Weight | 204.229 | |
| Description | Tryptophan is an amino acid commonly found as a component of total parenteral nutrition. | |
| ATC Classification | N06AX02 | |
| IUPAC Name | (2S)-2-Amino-3-(1H-Indol-3-Yl)Propanoic Acid | |
| InChI | Inchi=1S/C11H12N2O2/C12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/H1-4,6,9,13H,5,12H2,(H,14,15)/T9-/M0/S1 | |
| InChI Key | QIVBCDIJIAJPQS-VIFPVBQESA-N | |
| Canonical SMILES | N[C@@H](CC1=CNC2=C1C=CC=C2)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Tryptophan
| Severity level | ID | Name | Mechanism | Detail |
|---|