Drugs Information: Acetylcysteine
Basic Information
|
||
| ID | DDInter19 | |
| Drug Type | small molecule | |
| Molecular Formula | C5H9No3S | |
| Molecular Weight | 163.197 | |
| Description | Acetylcysteine is a medication that can be used as a mucolytic in patients with certain lung conditions and as an antidote for acetaminophen overdose. | |
| ATC Classification | R05CB01 S01XA08 V03AB23 | |
| IUPAC Name | (2R)-2-Acetamido-3-Sulfanylpropanoic Acid | |
| InChI | Inchi=1S/C5H9No3S/C1-3(7)6-4(2-10)5(8)9/H4,10H,2H2,1H3,(H,6,7)(H,8,9)/T4-/M0/S1 | |
| InChI Key | PWKSKIMOESPYIA-BYPYZUCNSA-N | |
| Canonical SMILES | CC(=O)N[C@@H](CS)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Acetylcysteine
| Severity level | ID | Name | Mechanism | Detail |
|---|