Drugs Information: Unoprostone (ophthalmic)
Basic Information
|
||
| ID | DDInter1900 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H38O5 | |
| Molecular Weight | 382.541 | |
| Description | Unoprostone is a prostaglandin analogue used to lower intraocular pressure in patients with open-angle glaucoma or ocular hypertension who are clinically unresponsive to other ocular antihypertensive agents. | |
| ATC Classification | S01EE02 | |
| IUPAC Name | (5Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-(3-Oxodecyl)Cyclopentyl]Hept-5-Enoic Acid | |
| InChI | Inchi=1S/C22H38O5/C1-2-3-4-5-8-11-17(23)14-15-19-18(20(24)16-21(19)25)12-9-6-7-10-13-22(26)27/H6,9,18-21,24-25H,2-5,7-8,10-16H2,1H3,(H,26,27)/B9-6-/T18-,19-,20+,21-/M1/S1 | |
| InChI Key | TVHAZVBUYQMHBC-SNHXEXRGSA-N | |
| Canonical SMILES | CCCCCCCC(=O)CC[C@H]1[C@H](O)C[C@H](O)[C@@H]1C\C=C/CCCC(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Unoprostone (ophthalmic)
| Severity level | ID | Name | Mechanism | Detail |
|---|