Drugs Information: Valproic acid
Basic Information
|
||
| ID | DDInter1913 | |
| Drug Type | small molecule | |
| Molecular Formula | C8H16O2 | |
| Molecular Weight | 144.214 | |
| Description | Valproic acid is an anticonvulsant used to control complex partial seizures and both simple and complex absence seizures. | |
| ATC Classification | N03AG01 | |
| IUPAC Name | 2-Propylpentanoic Acid | |
| InChI | Inchi=1S/C8H16O2/C1-3-5-7(6-4-2)8(9)10/H7H,3-6H2,1-2H3,(H,9,10) | |
| InChI Key | NIJJYAXOARWZEE-UHFFFAOYSA-N | |
| Canonical SMILES | CCCC(CCC)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Valproic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|